C17H21FN4O3S — CID 126796006
N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-4-(1H-pyrazol-5-yl)piperidine-1-carboxamide (PubChem CID 126796006) has the molecular formula C17H21FN4O3S and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-4-(1H-pyrazol-5-yl)piperidine-1-carboxamide.
| Compound Name | N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-4-(1H-pyrazol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126796006 |
| Molecular Formula | C17H21FN4O3S |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]-4-(1H-pyrazol-5-yl)piperidine-1-carboxamide |
| SMILES | CS(=O)(=O)Cc1ccc(NC(=O)N2CCC(c3ccn[nH]3)CC2)cc1F |
| InChI | InChI=1S/C17H21FN4O3S/c1-26(24,25)11-13-2-3-14(10-15(13)18)20-17(23)22-8-5-12(6-9-22)16-4-7-19-21-16/h2-4,7,10,12H,5-6,8-9,11H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | ULELACAUSOYPHR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |