C13H17FN2O3S — CID 71970733
N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 71970733) has the molecular formula C13H17FN2O3S and a molecular weight of 300.35 g/mol. Its IUPAC name is N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 71970733 |
| Molecular Formula | C13H17FN2O3S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | CS(=O)(=O)Cc1ccc(NC(=O)N2CCCC2)cc1F |
| InChI | InChI=1S/C13H17FN2O3S/c1-20(18,19)9-10-4-5-11(8-12(10)14)15-13(17)16-6-2-3-7-16/h4-5,8H,2-3,6-7,9H2,1H3,(H,15,17) |
| InChIKey | FKIGPDZHHJCWPY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |