C15H13ClFNO3S — CID 71919701
2-chloro-N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]benzamide (PubChem CID 71919701) has the molecular formula C15H13ClFNO3S and a molecular weight of 341.79 g/mol. Its IUPAC name is 2-chloro-N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 71919701 |
| Molecular Formula | C15H13ClFNO3S |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2-chloro-N-[3-fluoro-4-(methylsulfonylmethyl)phenyl]benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(NC(=O)c2ccccc2Cl)cc1F |
| InChI | InChI=1S/C15H13ClFNO3S/c1-22(20,21)9-10-6-7-11(8-14(10)17)18-15(19)12-4-2-3-5-13(12)16/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | MARXPLMLOHYNRN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |