C16H19FN4O2S — CID 154801582
N-(3-fluoro-4-methylsulfinylphenyl)-2-(1H-pyrazol-5-yl)piperidine-1-carboxamide (PubChem CID 154801582) has the molecular formula C16H19FN4O2S and a molecular weight of 350.42 g/mol. Its IUPAC name is N-(3-fluoro-4-methylsulfinylphenyl)-2-(1H-pyrazol-5-yl)piperidine-1-carboxamide.
| Compound Name | N-(3-fluoro-4-methylsulfinylphenyl)-2-(1H-pyrazol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 154801582 |
| Molecular Formula | C16H19FN4O2S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-(3-fluoro-4-methylsulfinylphenyl)-2-(1H-pyrazol-5-yl)piperidine-1-carboxamide |
| SMILES | CS(=O)c1ccc(NC(=O)N2CCCCC2c2ccn[nH]2)cc1F |
| InChI | InChI=1S/C16H19FN4O2S/c1-24(23)15-6-5-11(10-12(15)17)19-16(22)21-9-3-2-4-14(21)13-7-8-18-20-13/h5-8,10,14H,2-4,9H2,1H3,(H,18,20)(H,19,22) |
| InChIKey | ZNSXQYPQEALPMN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |