C15H21FN2O2S2 — CID 124591823
(3R)-N-[3-fluoro-4-[(S)-methylsulfinyl]phenyl]-3-methylsulfanylazepane-1-carboxamide (PubChem CID 124591823) has the molecular formula C15H21FN2O2S2 and a molecular weight of 344.48 g/mol. Its IUPAC name is (3R)-N-[3-fluoro-4-[(S)-methylsulfinyl]phenyl]-3-methylsulfanylazepane-1-carboxamide.
| Compound Name | (3R)-N-[3-fluoro-4-[(S)-methylsulfinyl]phenyl]-3-methylsulfanylazepane-1-carboxamide |
|---|---|
| PubChem CID | 124591823 |
| Molecular Formula | C15H21FN2O2S2 |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (3R)-N-[3-fluoro-4-[(S)-methylsulfinyl]phenyl]-3-methylsulfanylazepane-1-carboxamide |
| SMILES | CS[C@@H]1CCCCN(C(=O)Nc2ccc([S@](C)=O)c(F)c2)C1 |
| InChI | InChI=1S/C15H21FN2O2S2/c1-21-12-5-3-4-8-18(10-12)15(19)17-11-6-7-14(22(2)20)13(16)9-11/h6-7,9,12H,3-5,8,10H2,1-2H3,(H,17,19)/t12-,22+/m1/s1 |
| InChIKey | IHUBPUUORAUGJX-IPQOISQHSA-N |
| XLogP | 3.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |