C16H21F2N3O — CID 146121673
N-(3,4-difluorophenyl)-3-pyrrolidin-1-ylpiperidine-1-carboxamide (PubChem CID 146121673) has the molecular formula C16H21F2N3O and a molecular weight of 309.36 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3-pyrrolidin-1-ylpiperidine-1-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-3-pyrrolidin-1-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 146121673 |
| Molecular Formula | C16H21F2N3O |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-(3,4-difluorophenyl)-3-pyrrolidin-1-ylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)N1CCCC(N2CCCC2)C1 |
| InChI | InChI=1S/C16H21F2N3O/c17-14-6-5-12(10-15(14)18)19-16(22)21-9-3-4-13(11-21)20-7-1-2-8-20/h5-6,10,13H,1-4,7-9,11H2,(H,19,22) |
| InChIKey | MCLJFYDAZMXGRC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |