C21H31N3O3S — CID 52518848
(3R)-N-(3-cyclopentylsulfonylphenyl)-3-pyrrolidin-1-ylpiperidine-1-carboxamide (PubChem CID 52518848) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is (3R)-N-(3-cyclopentylsulfonylphenyl)-3-pyrrolidin-1-ylpiperidine-1-carboxamide.
| Compound Name | (3R)-N-(3-cyclopentylsulfonylphenyl)-3-pyrrolidin-1-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 52518848 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (3R)-N-(3-cyclopentylsulfonylphenyl)-3-pyrrolidin-1-ylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)C2CCCC2)c1)N1CCC[C@@H](N2CCCC2)C1 |
| InChI | InChI=1S/C21H31N3O3S/c25-21(24-14-6-8-18(16-24)23-12-3-4-13-23)22-17-7-5-11-20(15-17)28(26,27)19-9-1-2-10-19/h5,7,11,15,18-19H,1-4,6,8-10,12-14,16H2,(H,22,25)/t18-/m1/s1 |
| InChIKey | RNIBFJNPVVQZCL-GOSISDBHSA-N |
| XLogP | 3.49 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |