C18H26N4O3 — CID 99808497
methyl N-[4-[[(3S)-3-pyrrolidin-1-ylpiperidine-1-carbonyl]amino]phenyl]carbamate (PubChem CID 99808497) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is methyl N-[4-[[(3S)-3-pyrrolidin-1-ylpiperidine-1-carbonyl]amino]phenyl]carbamate.
| Compound Name | methyl N-[4-[[(3S)-3-pyrrolidin-1-ylpiperidine-1-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 99808497 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | methyl N-[4-[[(3S)-3-pyrrolidin-1-ylpiperidine-1-carbonyl]amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NC(=O)N2CCC[C@H](N3CCCC3)C2)cc1 |
| InChI | InChI=1S/C18H26N4O3/c1-25-18(24)20-15-8-6-14(7-9-15)19-17(23)22-12-4-5-16(13-22)21-10-2-3-11-21/h6-9,16H,2-5,10-13H2,1H3,(H,19,23)(H,20,24)/t16-/m0/s1 |
| InChIKey | UDWWILJKLAYHOT-INIZCTEOSA-N |
| XLogP | 2.96 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |