C21H24FN3O — CID 72931917
N-[3-(4-fluorophenyl)phenyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide (PubChem CID 72931917) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)phenyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide.
| Compound Name | N-[3-(4-fluorophenyl)phenyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 72931917 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-[3-(4-fluorophenyl)phenyl]-3-pyrrolidin-1-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccc(F)cc2)c1)N1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C21H24FN3O/c22-18-8-6-16(7-9-18)17-4-3-5-19(14-17)23-21(26)25-13-10-20(15-25)24-11-1-2-12-24/h3-9,14,20H,1-2,10-13,15H2,(H,23,26) |
| InChIKey | GFOBWLATCJZNQE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |