C25H24FN3O2 — CID 25451663
(3R)-N-[3-(4-fluorophenyl)phenyl]-1-(6-methylpyridine-2-carbonyl)piperidine-3-carboxamide (PubChem CID 25451663) has the molecular formula C25H24FN3O2 and a molecular weight of 417.48 g/mol. Its IUPAC name is (3R)-N-[3-(4-fluorophenyl)phenyl]-1-(6-methylpyridine-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(4-fluorophenyl)phenyl]-1-(6-methylpyridine-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 25451663 |
| Molecular Formula | C25H24FN3O2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (3R)-N-[3-(4-fluorophenyl)phenyl]-1-(6-methylpyridine-2-carbonyl)piperidine-3-carboxamide |
| SMILES | Cc1cccc(C(=O)N2CCC[C@@H](C(=O)Nc3cccc(-c4ccc(F)cc4)c3)C2)n1 |
| InChI | InChI=1S/C25H24FN3O2/c1-17-5-2-9-23(27-17)25(31)29-14-4-7-20(16-29)24(30)28-22-8-3-6-19(15-22)18-10-12-21(26)13-11-18/h2-3,5-6,8-13,15,20H,4,7,14,16H2,1H3,(H,28,30)/t20-/m1/s1 |
| InChIKey | XABMZCNTBJDLMP-HXUWFJFHSA-N |
| XLogP | 4.69 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |