C25H24FN3O2 — CID 42401368
(3S)-N-[3-(4-fluorophenyl)phenyl]-1-(6-methylpyridine-3-carbonyl)piperidine-3-carboxamide (PubChem CID 42401368) has the molecular formula C25H24FN3O2 and a molecular weight of 417.48 g/mol. Its IUPAC name is (3S)-N-[3-(4-fluorophenyl)phenyl]-1-(6-methylpyridine-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-(4-fluorophenyl)phenyl]-1-(6-methylpyridine-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42401368 |
| Molecular Formula | C25H24FN3O2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (3S)-N-[3-(4-fluorophenyl)phenyl]-1-(6-methylpyridine-3-carbonyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CCC[C@H](C(=O)Nc3cccc(-c4ccc(F)cc4)c3)C2)cn1 |
| InChI | InChI=1S/C25H24FN3O2/c1-17-7-8-20(15-27-17)25(31)29-13-3-5-21(16-29)24(30)28-23-6-2-4-19(14-23)18-9-11-22(26)12-10-18/h2,4,6-12,14-15,21H,3,5,13,16H2,1H3,(H,28,30)/t21-/m0/s1 |
| InChIKey | MYNXRJFXOIGFTE-NRFANRHFSA-N |
| XLogP | 4.69 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |