C24H26FN3O3 — CID 45195638
N-[3-(4-fluorophenyl)phenyl]-1-[2-(2-oxopyrrolidin-1-yl)acetyl]piperidine-3-carboxamide (PubChem CID 45195638) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)phenyl]-1-[2-(2-oxopyrrolidin-1-yl)acetyl]piperidine-3-carboxamide.
| Compound Name | N-[3-(4-fluorophenyl)phenyl]-1-[2-(2-oxopyrrolidin-1-yl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45195638 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-[3-(4-fluorophenyl)phenyl]-1-[2-(2-oxopyrrolidin-1-yl)acetyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccc(F)cc2)c1)C1CCCN(C(=O)CN2CCCC2=O)C1 |
| InChI | InChI=1S/C24H26FN3O3/c25-20-10-8-17(9-11-20)18-4-1-6-21(14-18)26-24(31)19-5-2-12-27(15-19)23(30)16-28-13-3-7-22(28)29/h1,4,6,8-11,14,19H,2-3,5,7,12-13,15-16H2,(H,26,31) |
| InChIKey | NSPJREYATVUENA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |