C22H23FN2O2 — CID 45236502
1-(cyclopropanecarbonyl)-N-[4-(3-fluorophenyl)phenyl]piperidine-3-carboxamide (PubChem CID 45236502) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyl)-N-[4-(3-fluorophenyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(cyclopropanecarbonyl)-N-[4-(3-fluorophenyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45236502 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-(cyclopropanecarbonyl)-N-[4-(3-fluorophenyl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cccc(F)c2)cc1)C1CCCN(C(=O)C2CC2)C1 |
| InChI | InChI=1S/C22H23FN2O2/c23-19-5-1-3-17(13-19)15-8-10-20(11-9-15)24-21(26)18-4-2-12-25(14-18)22(27)16-6-7-16/h1,3,5,8-11,13,16,18H,2,4,6-7,12,14H2,(H,24,26) |
| InChIKey | PQAUSYSQLWDPSI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |