C24H23FN2O3 — CID 56700889
N-[4-(3-fluorophenyl)phenyl]-1-(2-methylfuran-3-carbonyl)piperidine-3-carboxamide (PubChem CID 56700889) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[4-(3-fluorophenyl)phenyl]-1-(2-methylfuran-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-[4-(3-fluorophenyl)phenyl]-1-(2-methylfuran-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56700889 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[4-(3-fluorophenyl)phenyl]-1-(2-methylfuran-3-carbonyl)piperidine-3-carboxamide |
| SMILES | Cc1occc1C(=O)N1CCCC(C(=O)Nc2ccc(-c3cccc(F)c3)cc2)C1 |
| InChI | InChI=1S/C24H23FN2O3/c1-16-22(11-13-30-16)24(29)27-12-3-5-19(15-27)23(28)26-21-9-7-17(8-10-21)18-4-2-6-20(25)14-18/h2,4,6-11,13-14,19H,3,5,12,15H2,1H3,(H,26,28) |
| InChIKey | RTACVGJHSRIAHK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |