C25H24FN3O2 — CID 42522383
(3R)-N-[4-(3-fluorophenyl)phenyl]-1-(2-pyridin-2-ylacetyl)piperidine-3-carboxamide (PubChem CID 42522383) has the molecular formula C25H24FN3O2 and a molecular weight of 417.48 g/mol. Its IUPAC name is (3R)-N-[4-(3-fluorophenyl)phenyl]-1-(2-pyridin-2-ylacetyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[4-(3-fluorophenyl)phenyl]-1-(2-pyridin-2-ylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42522383 |
| Molecular Formula | C25H24FN3O2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (3R)-N-[4-(3-fluorophenyl)phenyl]-1-(2-pyridin-2-ylacetyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cccc(F)c2)cc1)[C@@H]1CCCN(C(=O)Cc2ccccn2)C1 |
| InChI | InChI=1S/C25H24FN3O2/c26-21-7-3-5-19(15-21)18-9-11-22(12-10-18)28-25(31)20-6-4-14-29(17-20)24(30)16-23-8-1-2-13-27-23/h1-3,5,7-13,15,20H,4,6,14,16-17H2,(H,28,31)/t20-/m1/s1 |
| InChIKey | LDWYOLLLGSCXCY-HXUWFJFHSA-N |
| XLogP | 4.31 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |