C24H21FN4O — CID 72856076
1-(3-cyano-2-pyridinyl)-N-[4-(3-fluorophenyl)phenyl]piperidine-3-carboxamide (PubChem CID 72856076) has the molecular formula C24H21FN4O and a molecular weight of 400.46 g/mol. Its IUPAC name is 1-(3-cyano-2-pyridinyl)-N-[4-(3-fluorophenyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(3-cyano-2-pyridinyl)-N-[4-(3-fluorophenyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 72856076 |
| Molecular Formula | C24H21FN4O |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-(3-cyano-2-pyridinyl)-N-[4-(3-fluorophenyl)phenyl]piperidine-3-carboxamide |
| SMILES | N#Cc1cccnc1N1CCCC(C(=O)Nc2ccc(-c3cccc(F)c3)cc2)C1 |
| InChI | InChI=1S/C24H21FN4O/c25-21-7-1-4-18(14-21)17-8-10-22(11-9-17)28-24(30)20-6-3-13-29(16-20)23-19(15-26)5-2-12-27-23/h1-2,4-5,7-12,14,20H,3,6,13,16H2,(H,28,30) |
| InChIKey | CENPICNLZWVUKL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |