C22H20F2N4O — CID 53033873
N-(3-fluorophenyl)-1-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide (PubChem CID 53033873) has the molecular formula C22H20F2N4O and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(3-fluorophenyl)-1-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide.
| Compound Name | N-(3-fluorophenyl)-1-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53033873 |
| Molecular Formula | C22H20F2N4O |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(3-fluorophenyl)-1-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)C1CCCN(c2ccnc(-c3ccc(F)cc3)n2)C1 |
| InChI | InChI=1S/C22H20F2N4O/c23-17-8-6-15(7-9-17)21-25-11-10-20(27-21)28-12-2-3-16(14-28)22(29)26-19-5-1-4-18(24)13-19/h1,4-11,13,16H,2-3,12,14H2,(H,26,29) |
| InChIKey | IPQCWAWHLDEIQS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |