C26H29FN4O — CID 95069805
(3R)-N-(4-butylphenyl)-1-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide (PubChem CID 95069805) has the molecular formula C26H29FN4O and a molecular weight of 432.54 g/mol. Its IUPAC name is (3R)-N-(4-butylphenyl)-1-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-(4-butylphenyl)-1-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95069805 |
| Molecular Formula | C26H29FN4O |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (3R)-N-(4-butylphenyl)-1-[2-(4-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)[C@@H]2CCCN(c3ccnc(-c4ccc(F)cc4)n3)C2)cc1 |
| InChI | InChI=1S/C26H29FN4O/c1-2-3-5-19-7-13-23(14-8-19)29-26(32)21-6-4-17-31(18-21)24-15-16-28-25(30-24)20-9-11-22(27)12-10-20/h7-16,21H,2-6,17-18H2,1H3,(H,29,32)/t21-/m1/s1 |
| InChIKey | XQUSUEMKYYXBJO-OAQYLSRUSA-N |
| XLogP | 5.48 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |