C25H28N4O — CID 95070038
(3S)-N-(3-phenylpropyl)-1-(2-phenylpyrimidin-4-yl)piperidine-3-carboxamide (PubChem CID 95070038) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is (3S)-N-(3-phenylpropyl)-1-(2-phenylpyrimidin-4-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-phenylpropyl)-1-(2-phenylpyrimidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95070038 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (3S)-N-(3-phenylpropyl)-1-(2-phenylpyrimidin-4-yl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)[C@H]1CCCN(c2ccnc(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C25H28N4O/c30-25(27-16-7-11-20-9-3-1-4-10-20)22-14-8-18-29(19-22)23-15-17-26-24(28-23)21-12-5-2-6-13-21/h1-6,9-10,12-13,15,17,22H,7-8,11,14,16,18-19H2,(H,27,30)/t22-/m0/s1 |
| InChIKey | BBUQJVFMAUZVCN-QFIPXVFZSA-N |
| XLogP | 4.11 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|