C26H29FN4O — CID 53071413
1-[2-(3-fluorophenyl)pyrimidin-4-yl]-N-(4-phenylbutan-2-yl)piperidine-3-carboxamide (PubChem CID 53071413) has the molecular formula C26H29FN4O and a molecular weight of 432.54 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)pyrimidin-4-yl]-N-(4-phenylbutan-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-[2-(3-fluorophenyl)pyrimidin-4-yl]-N-(4-phenylbutan-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53071413 |
| Molecular Formula | C26H29FN4O |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[2-(3-fluorophenyl)pyrimidin-4-yl]-N-(4-phenylbutan-2-yl)piperidine-3-carboxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)C1CCCN(c2ccnc(-c3cccc(F)c3)n2)C1 |
| InChI | InChI=1S/C26H29FN4O/c1-19(12-13-20-7-3-2-4-8-20)29-26(32)22-10-6-16-31(18-22)24-14-15-28-25(30-24)21-9-5-11-23(27)17-21/h2-5,7-9,11,14-15,17,19,22H,6,10,12-13,16,18H2,1H3,(H,29,32) |
| InChIKey | GXLHEHGHSWNPAS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |