C23H22BrFN4O — CID 53006582
N-[(4-bromophenyl)methyl]-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide (PubChem CID 53006582) has the molecular formula C23H22BrFN4O and a molecular weight of 469.36 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide.
| Compound Name | N-[(4-bromophenyl)methyl]-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53006582 |
| Molecular Formula | C23H22BrFN4O |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-1-[2-(3-fluorophenyl)pyrimidin-4-yl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Br)cc1)C1CCCN(c2ccnc(-c3cccc(F)c3)n2)C1 |
| InChI | InChI=1S/C23H22BrFN4O/c24-19-8-6-16(7-9-19)14-27-23(30)18-4-2-12-29(15-18)21-10-11-26-22(28-21)17-3-1-5-20(25)13-17/h1,3,5-11,13,18H,2,4,12,14-15H2,(H,27,30) |
| InChIKey | HTNGUBUYQNWKOU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |