C27H32N4O — CID 93068187
1-[2-(3-methylphenyl)pyrimidin-4-yl]-N-[(2S)-4-phenylbutan-2-yl]piperidine-4-carboxamide (PubChem CID 93068187) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-[2-(3-methylphenyl)pyrimidin-4-yl]-N-[(2S)-4-phenylbutan-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(3-methylphenyl)pyrimidin-4-yl]-N-[(2S)-4-phenylbutan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 93068187 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 1-[2-(3-methylphenyl)pyrimidin-4-yl]-N-[(2S)-4-phenylbutan-2-yl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(-c2nccc(N3CCC(C(=O)N[C@@H](C)CCc4ccccc4)CC3)n2)c1 |
| InChI | InChI=1S/C27H32N4O/c1-20-7-6-10-24(19-20)26-28-16-13-25(30-26)31-17-14-23(15-18-31)27(32)29-21(2)11-12-22-8-4-3-5-9-22/h3-10,13,16,19,21,23H,11-12,14-15,17-18H2,1-2H3,(H,29,32)/t21-/m0/s1 |
| InChIKey | ZHLPYMBRHHYEKR-NRFANRHFSA-N |
| XLogP | 4.81 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |