C26H30N4O — CID 53062120
1-[6-(3-methylphenyl)pyrimidin-4-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide (PubChem CID 53062120) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-[6-(3-methylphenyl)pyrimidin-4-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[6-(3-methylphenyl)pyrimidin-4-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53062120 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 1-[6-(3-methylphenyl)pyrimidin-4-yl]-N-(3-phenylpropyl)piperidine-4-carboxamide |
| SMILES | Cc1cccc(-c2cc(N3CCC(C(=O)NCCCc4ccccc4)CC3)ncn2)c1 |
| InChI | InChI=1S/C26H30N4O/c1-20-7-5-11-23(17-20)24-18-25(29-19-28-24)30-15-12-22(13-16-30)26(31)27-14-6-10-21-8-3-2-4-9-21/h2-5,7-9,11,17-19,22H,6,10,12-16H2,1H3,(H,27,31) |
| InChIKey | AZOXMRXQQCRFEY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|