C23H25FN2O4 — CID 26327809
methyl 4-[(3S)-3-[[4-(3-fluorophenyl)phenyl]carbamoyl]piperidin-1-yl]-4-oxobutanoate (PubChem CID 26327809) has the molecular formula C23H25FN2O4 and a molecular weight of 412.46 g/mol. Its IUPAC name is methyl 4-[(3S)-3-[[4-(3-fluorophenyl)phenyl]carbamoyl]piperidin-1-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[(3S)-3-[[4-(3-fluorophenyl)phenyl]carbamoyl]piperidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 26327809 |
| Molecular Formula | C23H25FN2O4 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | methyl 4-[(3S)-3-[[4-(3-fluorophenyl)phenyl]carbamoyl]piperidin-1-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CCC[C@H](C(=O)Nc2ccc(-c3cccc(F)c3)cc2)C1 |
| InChI | InChI=1S/C23H25FN2O4/c1-30-22(28)12-11-21(27)26-13-3-5-18(15-26)23(29)25-20-9-7-16(8-10-20)17-4-2-6-19(24)14-17/h2,4,6-10,14,18H,3,5,11-13,15H2,1H3,(H,25,29)/t18-/m0/s1 |
| InChIKey | LSTUUYHFXPIJPE-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |