C11H16N2OS2 — CID 100702386
(3S)-3-methylsulfanyl-N-thiophen-2-ylpiperidine-1-carboxamide (PubChem CID 100702386) has the molecular formula C11H16N2OS2 and a molecular weight of 256.40 g/mol. Its IUPAC name is (3S)-3-methylsulfanyl-N-thiophen-2-ylpiperidine-1-carboxamide.
| Compound Name | (3S)-3-methylsulfanyl-N-thiophen-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 100702386 |
| Molecular Formula | C11H16N2OS2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (3S)-3-methylsulfanyl-N-thiophen-2-ylpiperidine-1-carboxamide |
| SMILES | CS[C@H]1CCCN(C(=O)Nc2cccs2)C1 |
| InChI | InChI=1S/C11H16N2OS2/c1-15-9-4-2-6-13(8-9)11(14)12-10-5-3-7-16-10/h3,5,7,9H,2,4,6,8H2,1H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | CFFIBOUDFKZDPL-VIFPVBQESA-N |
| XLogP | 3.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |