C19H23FN2OS — CID 92503204
(2S)-N-(3-fluoro-4-methylphenyl)-2-(5-methylthiophen-2-yl)azepane-1-carboxamide (PubChem CID 92503204) has the molecular formula C19H23FN2OS and a molecular weight of 346.47 g/mol. Its IUPAC name is (2S)-N-(3-fluoro-4-methylphenyl)-2-(5-methylthiophen-2-yl)azepane-1-carboxamide.
| Compound Name | (2S)-N-(3-fluoro-4-methylphenyl)-2-(5-methylthiophen-2-yl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 92503204 |
| Molecular Formula | C19H23FN2OS |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (2S)-N-(3-fluoro-4-methylphenyl)-2-(5-methylthiophen-2-yl)azepane-1-carboxamide |
| SMILES | Cc1ccc([C@@H]2CCCCCN2C(=O)Nc2ccc(C)c(F)c2)s1 |
| InChI | InChI=1S/C19H23FN2OS/c1-13-7-9-15(12-16(13)20)21-19(23)22-11-5-3-4-6-17(22)18-10-8-14(2)24-18/h7-10,12,17H,3-6,11H2,1-2H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | PVOMKCSRRYLXFJ-KRWDZBQOSA-N |
| XLogP | 5.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |