C19H21F3N2OS — CID 22586911
2-(5-methylthiophen-2-yl)-N-[2-(trifluoromethyl)phenyl]azepane-1-carboxamide (PubChem CID 22586911) has the molecular formula C19H21F3N2OS and a molecular weight of 382.45 g/mol. Its IUPAC name is 2-(5-methylthiophen-2-yl)-N-[2-(trifluoromethyl)phenyl]azepane-1-carboxamide.
| Compound Name | 2-(5-methylthiophen-2-yl)-N-[2-(trifluoromethyl)phenyl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 22586911 |
| Molecular Formula | C19H21F3N2OS |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-(5-methylthiophen-2-yl)-N-[2-(trifluoromethyl)phenyl]azepane-1-carboxamide |
| SMILES | Cc1ccc(C2CCCCCN2C(=O)Nc2ccccc2C(F)(F)F)s1 |
| InChI | InChI=1S/C19H21F3N2OS/c1-13-10-11-17(26-13)16-9-3-2-6-12-24(16)18(25)23-15-8-5-4-7-14(15)19(20,21)22/h4-5,7-8,10-11,16H,2-3,6,9,12H2,1H3,(H,23,25) |
| InChIKey | OBXOOSDVCMQKJK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |