C19H19F3N2O — CID 94080902
(2R)-2-(3-methylphenyl)-N-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 94080902) has the molecular formula C19H19F3N2O and a molecular weight of 348.37 g/mol. Its IUPAC name is (2R)-2-(3-methylphenyl)-N-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | (2R)-2-(3-methylphenyl)-N-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94080902 |
| Molecular Formula | C19H19F3N2O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (2R)-2-(3-methylphenyl)-N-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | Cc1cccc([C@H]2CCCN2C(=O)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3N2O/c1-13-6-4-7-14(12-13)17-10-5-11-24(17)18(25)23-16-9-3-2-8-15(16)19(20,21)22/h2-4,6-9,12,17H,5,10-11H2,1H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | KDMPCXBHEXHRGY-QGZVFWFLSA-N |
| XLogP | 5.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |