C9H13N3S — CID 130735866
4-[2-(2,5-dihydropyrrol-1-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 130735866) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 4-[2-(2,5-dihydropyrrol-1-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2-(2,5-dihydropyrrol-1-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130735866 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 4-[2-(2,5-dihydropyrrol-1-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(CCN2CC=CC2)cs1 |
| InChI | InChI=1S/C9H13N3S/c10-9-11-8(7-13-9)3-6-12-4-1-2-5-12/h1-2,7H,3-6H2,(H2,10,11) |
| InChIKey | AXYUYDAALQBJAX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|