C12H22N4S — CID 65484061
4-[2-(4-propylpiperazin-1-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 65484061) has the molecular formula C12H22N4S and a molecular weight of 254.40 g/mol. Its IUPAC name is 4-[2-(4-propylpiperazin-1-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2-(4-propylpiperazin-1-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65484061 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 4-[2-(4-propylpiperazin-1-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | CCCN1CCN(CCc2csc(N)n2)CC1 |
| InChI | InChI=1S/C12H22N4S/c1-2-4-15-6-8-16(9-7-15)5-3-11-10-17-12(13)14-11/h10H,2-9H2,1H3,(H2,13,14) |
| InChIKey | XJXHGZVRJDDRFX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |