C13H16N2OS — CID 28913056
4-[(2,3,6-trimethylphenoxy)methyl]-1,3-thiazol-2-amine (PubChem CID 28913056) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-[(2,3,6-trimethylphenoxy)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[(2,3,6-trimethylphenoxy)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 28913056 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4-[(2,3,6-trimethylphenoxy)methyl]-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(C)c(OCc2csc(N)n2)c1C |
| InChI | InChI=1S/C13H16N2OS/c1-8-4-5-9(2)12(10(8)3)16-6-11-7-17-13(14)15-11/h4-5,7H,6H2,1-3H3,(H2,14,15) |
| InChIKey | XJHLBSIBLMWYSZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |