C10H9IN2OS — CID 43144743
4-[(4-iodophenoxy)methyl]-1,3-thiazol-2-amine (PubChem CID 43144743) has the molecular formula C10H9IN2OS and a molecular weight of 332.17 g/mol. Its IUPAC name is 4-[(4-iodophenoxy)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[(4-iodophenoxy)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43144743 |
| Molecular Formula | C10H9IN2OS |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 4-[(4-iodophenoxy)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(COc2ccc(I)cc2)cs1 |
| InChI | InChI=1S/C10H9IN2OS/c11-7-1-3-9(4-2-7)14-5-8-6-15-10(12)13-8/h1-4,6H,5H2,(H2,12,13) |
| InChIKey | XRYLPBHCJZDNQR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|