C13H22ClNOS — CID 43138236
4-(chloromethyl)-2-(octan-2-yloxymethyl)-1,3-thiazole (PubChem CID 43138236) has the molecular formula C13H22ClNOS and a molecular weight of 275.84 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(octan-2-yloxymethyl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(octan-2-yloxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 43138236 |
| Molecular Formula | C13H22ClNOS |
| Molecular Weight | 275.84 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 4-(chloromethyl)-2-(octan-2-yloxymethyl)-1,3-thiazole |
| SMILES | CCCCCCC(C)OCc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H22ClNOS/c1-3-4-5-6-7-11(2)16-9-13-15-12(8-14)10-17-13/h10-11H,3-9H2,1-2H3 |
| InChIKey | AUELJQILOLCXCD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|