C18H33NS — CID 122184889
4-(2-methylpropyl)-2-undecyl-1,3-thiazole (PubChem CID 122184889) has the molecular formula C18H33NS and a molecular weight of 295.54 g/mol. Its IUPAC name is 4-(2-methylpropyl)-2-undecyl-1,3-thiazole.
| Compound Name | 4-(2-methylpropyl)-2-undecyl-1,3-thiazole |
|---|---|
| PubChem CID | 122184889 |
| Molecular Formula | C18H33NS |
| Molecular Weight | 295.54 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 4-(2-methylpropyl)-2-undecyl-1,3-thiazole |
| SMILES | CCCCCCCCCCCc1nc(CC(C)C)cs1 |
| InChI | InChI=1S/C18H33NS/c1-4-5-6-7-8-9-10-11-12-13-18-19-17(15-20-18)14-16(2)3/h15-16H,4-14H2,1-3H3 |
| InChIKey | WKYNNGVEHMXIDJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|