About acetic acid;4-ethyl-2-tridecyl-1,3-thiazole
acetic acid;4-ethyl-2-tridecyl-1,3-thiazole (PubChem CID 70113929) has the molecular formula C20H37NO2S
and a molecular weight of 355.59 g/mol. Its IUPAC name is acetic acid;4-ethyl-2-tridecyl-1,3-thiazole.
Molecular Properties
| Compound Name | acetic acid;4-ethyl-2-tridecyl-1,3-thiazole |
| PubChem CID | 70113929 |
| Molecular Formula | C20H37NO2S |
| Molecular Weight | 355.59 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | acetic acid;4-ethyl-2-tridecyl-1,3-thiazole |
| SMILES | CC(=O)O.CCCCCCCCCCCCCc1nc(CC)cs1 |
| InChI | InChI=1S/C18H33NS.C2H4O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-18-19-17(4-2)16-20-18;1-2(3)4/h16H,3-15H2,1-2H3;1H3,(H,3,4) |
| InChIKey | BOVXSRDFHUWMJI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;4-ethyl-2-tridecyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;4-ethyl-2-tridecyl-1,3-thiazole?
The IUPAC name of acetic acid;4-ethyl-2-tridecyl-1,3-thiazole (CID 70113929) is acetic acid;4-ethyl-2-tridecyl-1,3-thiazole.
What is the SMILES notation for acetic acid;4-ethyl-2-tridecyl-1,3-thiazole?
The canonical SMILES for acetic acid;4-ethyl-2-tridecyl-1,3-thiazole is CC(=O)O.CCCCCCCCCCCCCc1nc(CC)cs1.
What is the InChIKey of acetic acid;4-ethyl-2-tridecyl-1,3-thiazole?
The InChIKey is BOVXSRDFHUWMJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NS.C2H4O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-18-19-17(4-2)16-20-18;1-2(3)4/h16H,3-15H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;4-ethyl-2-tridecyl-1,3-thiazole?
acetic acid;4-ethyl-2-tridecyl-1,3-thiazole has a molecular weight of 355.59 g/mol, XLogP of 6.65, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-ethyl-2-tridecyl-1,3-thiazole is sourced from PubChem (CID 70113929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).