C11H17NO2S2 — CID 102626094
2-[(4-hexyl-1,3-thiazol-2-yl)sulfanyl]acetic acid (PubChem CID 102626094) has the molecular formula C11H17NO2S2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-[(4-hexyl-1,3-thiazol-2-yl)sulfanyl]acetic acid.
| Compound Name | 2-[(4-hexyl-1,3-thiazol-2-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 102626094 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-[(4-hexyl-1,3-thiazol-2-yl)sulfanyl]acetic acid |
| SMILES | CCCCCCc1csc(SCC(=O)O)n1 |
| InChI | InChI=1S/C11H17NO2S2/c1-2-3-4-5-6-9-7-15-11(12-9)16-8-10(13)14/h7H,2-6,8H2,1H3,(H,13,14) |
| InChIKey | VCCCQURZOCWDHX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|