C12H17N3O4S2 — CID 45395772
2-[2-[2-(butylcarbamoylamino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetic acid (PubChem CID 45395772) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-[2-[2-(butylcarbamoylamino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[2-(butylcarbamoylamino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 45395772 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-[2-[2-(butylcarbamoylamino)-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCCCNC(=O)NC(=O)CSc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C12H17N3O4S2/c1-2-3-4-13-11(19)15-9(16)7-21-12-14-8(6-20-12)5-10(17)18/h6H,2-5,7H2,1H3,(H,17,18)(H2,13,15,16,19) |
| InChIKey | CXEFEUPKJVRGBO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|