C16H19FN2OS2 — CID 16899799
N-butyl-2-[2-[(4-fluorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]acetamide (PubChem CID 16899799) has the molecular formula C16H19FN2OS2 and a molecular weight of 338.47 g/mol. Its IUPAC name is N-butyl-2-[2-[(4-fluorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-butyl-2-[2-[(4-fluorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 16899799 |
| Molecular Formula | C16H19FN2OS2 |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-butyl-2-[2-[(4-fluorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]acetamide |
| SMILES | CCCCNC(=O)Cc1csc(SCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H19FN2OS2/c1-2-3-8-18-15(20)9-14-11-22-16(19-14)21-10-12-4-6-13(17)7-5-12/h4-7,11H,2-3,8-10H2,1H3,(H,18,20) |
| InChIKey | CSEXBSLYCHJFHM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|