C12H20N2OS2 — CID 47115851
N-hexyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 47115851) has the molecular formula C12H20N2OS2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-hexyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-hexyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 47115851 |
| Molecular Formula | C12H20N2OS2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N-hexyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCCCCCNC(=O)CSc1nc(C)cs1 |
| InChI | InChI=1S/C12H20N2OS2/c1-3-4-5-6-7-13-11(15)9-17-12-14-10(2)8-16-12/h8H,3-7,9H2,1-2H3,(H,13,15) |
| InChIKey | OCQRNAJOGQMMGZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|