C6H6NNaO2S2 — CID 84818244
sodium 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetate (PubChem CID 84818244) has the molecular formula C6H6NNaO2S2 and a molecular weight of 211.24 g/mol. Its IUPAC name is sodium 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetate.
| Compound Name | sodium 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 84818244 |
| Molecular Formula | C6H6NNaO2S2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 210.97 |
| IUPAC Name | sodium 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetate |
| SMILES | Cc1csc(SCC(=O)[O-])n1.[Na+] |
| InChI | InChI=1S/C6H7NO2S2.Na/c1-4-2-10-6(7-4)11-3-5(8)9;/h2H,3H2,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | HKPTWGVGEKDJCQ-UHFFFAOYSA-M |
| XLogP | -2.70 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |