C7H8BF3KNS2 — CID 106746955
potassium trifluoro-[3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]prop-1-en-2-yl]boranuide (PubChem CID 106746955) has the molecular formula C7H8BF3KNS2 and a molecular weight of 277.19 g/mol. Its IUPAC name is potassium trifluoro-[3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]prop-1-en-2-yl]boranuide.
| Compound Name | potassium trifluoro-[3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]prop-1-en-2-yl]boranuide |
|---|---|
| PubChem CID | 106746955 |
| Molecular Formula | C7H8BF3KNS2 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | potassium trifluoro-[3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]prop-1-en-2-yl]boranuide |
| SMILES | C=C(CSc1nc(C)cs1)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C7H8BF3NS2.K/c1-5(8(9,10)11)3-13-7-12-6(2)4-14-7;/h4H,1,3H2,2H3;/q-1;+1 |
| InChIKey | RRRPUVLOJTZGJW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|