C18H14N2OS2 — CID 3437222
1-carbazol-9-yl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethanone (PubChem CID 3437222) has the molecular formula C18H14N2OS2 and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-carbazol-9-yl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethanone.
| Compound Name | 1-carbazol-9-yl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 3437222 |
| Molecular Formula | C18H14N2OS2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1-carbazol-9-yl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethanone |
| SMILES | Cc1csc(SCC(=O)n2c3ccccc3c3ccccc32)n1 |
| InChI | InChI=1S/C18H14N2OS2/c1-12-10-22-18(19-12)23-11-17(21)20-15-8-4-2-6-13(15)14-7-3-5-9-16(14)20/h2-10H,11H2,1H3 |
| InChIKey | LCRYBZNNTIYYBV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |