C19H22N2O2S2 — CID 39754491
3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-pentyl-1-benzofuran-2-carboxamide (PubChem CID 39754491) has the molecular formula C19H22N2O2S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-pentyl-1-benzofuran-2-carboxamide.
| Compound Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-pentyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 39754491 |
| Molecular Formula | C19H22N2O2S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-pentyl-1-benzofuran-2-carboxamide |
| SMILES | CCCCCNC(=O)c1oc2ccccc2c1CSc1nc(C)cs1 |
| InChI | InChI=1S/C19H22N2O2S2/c1-3-4-7-10-20-18(22)17-15(12-25-19-21-13(2)11-24-19)14-8-5-6-9-16(14)23-17/h5-6,8-9,11H,3-4,7,10,12H2,1-2H3,(H,20,22) |
| InChIKey | YUFYJLLNQYRHPV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|