C23H25N5O3S2 — CID 55867404
3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1-benzofuran-2-carboxamide (PubChem CID 55867404) has the molecular formula C23H25N5O3S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55867404 |
| Molecular Formula | C23H25N5O3S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1csc(SCc2c(C(=O)NCCCn3nc4n(c3=O)CCCC4)oc3ccccc23)n1 |
| InChI | InChI=1S/C23H25N5O3S2/c1-15-13-32-22(25-15)33-14-17-16-7-2-3-8-18(16)31-20(17)21(29)24-10-6-12-28-23(30)27-11-5-4-9-19(27)26-28/h2-3,7-8,13H,4-6,9-12,14H2,1H3,(H,24,29) |
| InChIKey | GCEPHKQEQOERSW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|