C25H24N4O3S2 — CID 39755587
N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-1-benzofuran-2-carbohydrazide (PubChem CID 39755587) has the molecular formula C25H24N4O3S2 and a molecular weight of 492.63 g/mol. Its IUPAC name is N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 39755587 |
| Molecular Formula | C25H24N4O3S2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1csc(SCc2c(C(=O)NNC(=O)CN3CCCc4ccccc43)oc3ccccc23)n1 |
| InChI | InChI=1S/C25H24N4O3S2/c1-16-14-33-25(26-16)34-15-19-18-9-3-5-11-21(18)32-23(19)24(31)28-27-22(30)13-29-12-6-8-17-7-2-4-10-20(17)29/h2-5,7,9-11,14H,6,8,12-13,15H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | NXINKFNSTDKDNU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|