C23H21N3O4S2 — CID 55363133
N'-[2-(3-methylphenoxy)acetyl]-3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-1-benzofuran-2-carbohydrazide (PubChem CID 55363133) has the molecular formula C23H21N3O4S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N'-[2-(3-methylphenoxy)acetyl]-3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[2-(3-methylphenoxy)acetyl]-3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 55363133 |
| Molecular Formula | C23H21N3O4S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | N'-[2-(3-methylphenoxy)acetyl]-3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)c2oc3ccccc3c2CSc2nc(C)cs2)c1 |
| InChI | InChI=1S/C23H21N3O4S2/c1-14-6-5-7-16(10-14)29-11-20(27)25-26-22(28)21-18(13-32-23-24-15(2)12-31-23)17-8-3-4-9-19(17)30-21/h3-10,12H,11,13H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | YIHWEHMUUDQCEO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|