C20H13F3N2O2S2 — CID 30272964
3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-(2,3,4-trifluorophenyl)-1-benzofuran-2-carboxamide (PubChem CID 30272964) has the molecular formula C20H13F3N2O2S2 and a molecular weight of 434.46 g/mol. Its IUPAC name is 3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-(2,3,4-trifluorophenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-(2,3,4-trifluorophenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 30272964 |
| Molecular Formula | C20H13F3N2O2S2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-N-(2,3,4-trifluorophenyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1csc(SCc2c(C(=O)Nc3ccc(F)c(F)c3F)oc3ccccc23)n1 |
| InChI | InChI=1S/C20H13F3N2O2S2/c1-10-8-28-20(24-10)29-9-12-11-4-2-3-5-15(11)27-18(12)19(26)25-14-7-6-13(21)16(22)17(14)23/h2-8H,9H2,1H3,(H,25,26) |
| InChIKey | PYYSGZHISRNMEL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|