2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid

C8H9NO4S2 — CID 21298309

IUPAC2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid
SMILESCC(C(=O)O)c1csc(SCC(=O)O)n1
InChIInChI=1S/C8H9NO4S2/c1-4(7(12)13)5-2-14-8(9-5)15-3-6(10)11/h2,4H,3H2,1H3,(H,10,11)(H,12,13)
InChIKeyHFXFWOZQYITRSY-UHFFFAOYSA-N
MW247.30 g/mol
LogP1.51
Rot. Bonds5

About 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid

2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 21298309) has the molecular formula C8H9NO4S2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid.

Molecular Properties

Compound Name2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid
PubChem CID21298309
Molecular FormulaC8H9NO4S2
Molecular Weight247.30 g/mol
Exact Mass247.00
IUPAC Name2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid
SMILESCC(C(=O)O)c1csc(SCC(=O)O)n1
InChIInChI=1S/C8H9NO4S2/c1-4(7(12)13)5-2-14-8(9-5)15-3-6(10)11/h2,4H,3H2,1H3,(H,10,11)(H,12,13)
InChIKeyHFXFWOZQYITRSY-UHFFFAOYSA-N
XLogP1.51
TPSA87.49 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.30
LogP ≤ 51.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid?
The IUPAC name of 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid (CID 21298309) is 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid.
What is the SMILES notation for 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid?
The canonical SMILES for 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid is CC(C(=O)O)c1csc(SCC(=O)O)n1.
What is the InChIKey of 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid?
The InChIKey is HFXFWOZQYITRSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4S2/c1-4(7(12)13)5-2-14-8(9-5)15-3-6(10)11/h2,4H,3H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid?
2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid has a molecular weight of 247.30 g/mol, XLogP of 1.51, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid is sourced from PubChem (CID 21298309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).