About 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid
2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 21298309) has the molecular formula C8H9NO4S2
and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid.
Analyze 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid?
The IUPAC name of 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid (CID 21298309) is 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid.
What is the SMILES notation for 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid?
The canonical SMILES for 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid is CC(C(=O)O)c1csc(SCC(=O)O)n1.
What is the InChIKey of 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid?
The InChIKey is HFXFWOZQYITRSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4S2/c1-4(7(12)13)5-2-14-8(9-5)15-3-6(10)11/h2,4H,3H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid?
2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid has a molecular weight of 247.30 g/mol, XLogP of 1.51, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(carboxymethylsulfanyl)-1,3-thiazol-4-yl]propanoic acid is sourced from PubChem (CID 21298309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).