C8H8N2O2S — CID 51674828
(2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid (PubChem CID 51674828) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid.
| Compound Name | (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid |
|---|---|
| PubChem CID | 51674828 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid |
| SMILES | C[C@@H](C(=O)O)c1cn2ccsc2n1 |
| InChI | InChI=1S/C8H8N2O2S/c1-5(7(11)12)6-4-10-2-3-13-8(10)9-6/h2-5H,1H3,(H,11,12)/t5-/m1/s1 |
| InChIKey | IYSLDKRLUATOEC-RXMQYKEDSA-N |
| XLogP | 1.58 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |