(2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid

C8H8N2O2S — CID 51674828

IUPAC(2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid
SMILESC[C@@H](C(=O)O)c1cn2ccsc2n1
InChIInChI=1S/C8H8N2O2S/c1-5(7(11)12)6-4-10-2-3-13-8(10)9-6/h2-5H,1H3,(H,11,12)/t5-/m1/s1
InChIKeyIYSLDKRLUATOEC-RXMQYKEDSA-N
MW196.23 g/mol
LogP1.58
Rot. Bonds2

About (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid

(2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid (PubChem CID 51674828) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid.

Molecular Properties

Compound Name(2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid
PubChem CID51674828
Molecular FormulaC8H8N2O2S
Molecular Weight196.23 g/mol
Exact Mass196.03
IUPAC Name(2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid
SMILESC[C@@H](C(=O)O)c1cn2ccsc2n1
InChIInChI=1S/C8H8N2O2S/c1-5(7(11)12)6-4-10-2-3-13-8(10)9-6/h2-5H,1H3,(H,11,12)/t5-/m1/s1
InChIKeyIYSLDKRLUATOEC-RXMQYKEDSA-N
XLogP1.58
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.23
LogP ≤ 51.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid?
The IUPAC name of (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid (CID 51674828) is (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid.
What is the SMILES notation for (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid?
The canonical SMILES for (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid is C[C@@H](C(=O)O)c1cn2ccsc2n1.
What is the InChIKey of (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid?
The InChIKey is IYSLDKRLUATOEC-RXMQYKEDSA-N. The full InChI is InChI=1S/C8H8N2O2S/c1-5(7(11)12)6-4-10-2-3-13-8(10)9-6/h2-5H,1H3,(H,11,12)/t5-/m1/s1.
What are the key properties of (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid?
(2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid has a molecular weight of 196.23 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid is sourced from PubChem (CID 51674828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).