About 2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride
2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride (PubChem CID 53444457) has the molecular formula C8H9ClN2O2S
and a molecular weight of 232.69 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride.
Analyze 2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride?
The IUPAC name of 2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride (CID 53444457) is 2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride.
What is the SMILES notation for 2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride?
The canonical SMILES for 2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride is CC(C(=O)O)c1cn2ccsc2n1.Cl.
What is the InChIKey of 2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride?
The InChIKey is FFUHKELFVFOZGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S.ClH/c1-5(7(11)12)6-4-10-2-3-13-8(10)9-6;/h2-5H,1H3,(H,11,12);1H.
What are the key properties of 2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride?
2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride has a molecular weight of 232.69 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[2,1-b][1,3]thiazol-6-ylpropanoic acid;hydrochloride is sourced from PubChem (CID 53444457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).